C29H41F2N3O4 — CID 11642290
3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(2,4-difluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 11642290) has the molecular formula C29H41F2N3O4 and a molecular weight of 533.66 g/mol. Its IUPAC name is 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(2,4-difluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(2,4-difluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11642290 |
| Molecular Formula | C29H41F2N3O4 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[(2,4-difluorophenyl)-(3-methoxypropoxy)methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | COCCCOC(c1ccc(F)cc1F)C1CCCN(c2c(NC(CN)CC3CCCCC3)c(=O)c2=O)C1 |
| InChI | InChI=1S/C29H41F2N3O4/c1-37-13-6-14-38-29(23-11-10-21(30)16-24(23)31)20-9-5-12-34(18-20)26-25(27(35)28(26)36)33-22(17-32)15-19-7-3-2-4-8-19/h10-11,16,19-20,22,29,33H,2-9,12-15,17-18,32H2,1H3 |
| InChIKey | DKKLBFVOWLPXFY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|