C12H13Cl2N3O2S2 — CID 1164238
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide (PubChem CID 1164238) has the molecular formula C12H13Cl2N3O2S2 and a molecular weight of 366.30 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 1164238 |
| Molecular Formula | C12H13Cl2N3O2S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2,5-dichlorobenzenesulfonamide |
| SMILES | CC(C)(C)c1nnc(NS(=O)(=O)c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C12H13Cl2N3O2S2/c1-12(2,3)10-15-16-11(20-10)17-21(18,19)9-6-7(13)4-5-8(9)14/h4-6H,1-3H3,(H,16,17) |
| InChIKey | ZXRFLCNCHVQTLX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |