C25H28N6O5S2 — CID 11642522
tert-butyl N-[3-[[2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carbonyl]amino]propyl]carbamate (PubChem CID 11642522) has the molecular formula C25H28N6O5S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carbonyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 11642522 |
| Molecular Formula | C25H28N6O5S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | tert-butyl N-[3-[[2-(3-sulfamoylanilino)thieno[2,3-h]quinazoline-8-carbonyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)c1cc2c(ccc3cnc(Nc4cccc(S(N)(=O)=O)c4)nc32)s1 |
| InChI | InChI=1S/C25H28N6O5S2/c1-25(2,3)36-24(33)28-11-5-10-27-22(32)20-13-18-19(37-20)9-8-15-14-29-23(31-21(15)18)30-16-6-4-7-17(12-16)38(26,34)35/h4,6-9,12-14H,5,10-11H2,1-3H3,(H,27,32)(H,28,33)(H2,26,34,35)(H,29,30,31) |
| InChIKey | YRMIVPIUCJOFGI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|