C34H28O2P2S — CID 11642587
13-[3-[(2S,5S)-2,5-dimethylphospholan-1-yl]-1-benzothiophen-2-yl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene (PubChem CID 11642587) has the molecular formula C34H28O2P2S and a molecular weight of 562.61 g/mol. Its IUPAC name is 13-[3-[(2S,5S)-2,5-dimethylphospholan-1-yl]-1-benzothiophen-2-yl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene.
| Compound Name | 13-[3-[(2S,5S)-2,5-dimethylphospholan-1-yl]-1-benzothiophen-2-yl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
|---|---|
| PubChem CID | 11642587 |
| Molecular Formula | C34H28O2P2S |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 13-[3-[(2S,5S)-2,5-dimethylphospholan-1-yl]-1-benzothiophen-2-yl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaene |
| SMILES | C[C@H]1CC[C@H](C)P1c1c(-p2oc3ccc4ccccc4c3c3c(ccc4ccccc43)o2)sc2ccccc12 |
| InChI | InChI=1S/C34H28O2P2S/c1-21-15-16-22(2)37(21)33-27-13-7-8-14-30(27)39-34(33)38-35-28-19-17-23-9-3-5-11-25(23)31(28)32-26-12-6-4-10-24(26)18-20-29(32)36-38/h3-14,17-22H,15-16H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | ZAXPYJUUKBUPHH-VXKWHMMOSA-N |
| XLogP | 11.48 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|