C33H43NO8 — CID 11642735
[(2R,3R,4S)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methyl-1-oxopentan-3-yl] 3-methylbutanoate (PubChem CID 11642735) has the molecular formula C33H43NO8 and a molecular weight of 581.71 g/mol. Its IUPAC name is [(2R,3R,4S)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methyl-1-oxopentan-3-yl] 3-methylbutanoate.
| Compound Name | [(2R,3R,4S)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methyl-1-oxopentan-3-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 11642735 |
| Molecular Formula | C33H43NO8 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | [(2R,3R,4S)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]-2-methyl-1-oxopentan-3-yl] 3-methylbutanoate |
| SMILES | COc1ccc([C@@H]2OC[C@@H](C)[C@H]([C@H](C)[C@@H](OC(=O)CC(C)C)[C@@H](C)C(=O)N3C(=O)OC[C@H]3Cc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C33H43NO8/c1-20(2)16-28(35)41-30(22(4)29-21(3)18-39-32(42-29)25-12-14-27(38-6)15-13-25)23(5)31(36)34-26(19-40-33(34)37)17-24-10-8-7-9-11-24/h7-15,20-23,26,29-30,32H,16-19H2,1-6H3/t21-,22+,23-,26-,29-,30-,32-/m1/s1 |
| InChIKey | MCJMMKZONNSUDY-RBSPTMQOSA-N |
| XLogP | 5.57 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |