C34H34ClN5O4 — CID 11642959
(S)-4a,8a-dihydroquinolin-4-yl-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 11642959) has the molecular formula C34H34ClN5O4 and a molecular weight of 612.13 g/mol. Its IUPAC name is (S)-4a,8a-dihydroquinolin-4-yl-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (S)-4a,8a-dihydroquinolin-4-yl-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 11642959 |
| Molecular Formula | C34H34ClN5O4 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | (S)-4a,8a-dihydroquinolin-4-yl-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methanol;5-(2-chlorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](O)C1=CC=NC2C=CC=CC12.O=C1CN=C(c2ccccc2Cl)c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C19H24N2O.C15H10ClN3O3/c1-2-13-12-21-10-8-14(13)11-18(21)19(22)16-7-9-20-17-6-4-3-5-15(16)17;16-12-4-2-1-3-10(12)15-11-7-9(19(21)22)5-6-13(11)18-14(20)8-17-15/h2-7,9,13-15,17-19,22H,1,8,10-12H2;1-7H,8H2,(H,18,20)/t13-,14-,15?,17?,18+,19-;/m0./s1 |
| InChIKey | HZOCDDSRFHYCFS-LREZUBLLSA-N |
| XLogP | 5.40 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|