C36H50N6O4 — CID 11643084
(2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-amino-4-(3-ethoxycarbonylpiperidin-1-yl)phenyl]-6-cyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 11643084) has the molecular formula C36H50N6O4 and a molecular weight of 630.83 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-amino-4-(3-ethoxycarbonylpiperidin-1-yl)phenyl]-6-cyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-amino-4-(3-ethoxycarbonylpiperidin-1-yl)phenyl]-6-cyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 11643084 |
| Molecular Formula | C36H50N6O4 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.39 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-amino-4-(3-ethoxycarbonylpiperidin-1-yl)phenyl]-6-cyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ccc(-c3nc4c(C(=O)OC5C(C(C)(C)C)CC(C)CC5C(C)(C)C)c(C#N)cn4[nH]3)cc2N)C1 |
| InChI | InChI=1S/C36H50N6O4/c1-9-45-33(43)23-11-10-14-41(19-23)28-13-12-22(17-27(28)38)31-39-32-29(24(18-37)20-42(32)40-31)34(44)46-30-25(35(3,4)5)15-21(2)16-26(30)36(6,7)8/h12-13,17,20-21,23,25-26,30H,9-11,14-16,19,38H2,1-8H3,(H,39,40) |
| InChIKey | SNUPIDSFIRXIEK-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|