C12H20O — CID 11644027
2-[(1R,3R,5S)-3,6,6-trimethyl-2-methylidene-3-bicyclo[3.1.0]hexanyl]ethanol (PubChem CID 11644027) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-[(1R,3R,5S)-3,6,6-trimethyl-2-methylidene-3-bicyclo[3.1.0]hexanyl]ethanol.
| Compound Name | 2-[(1R,3R,5S)-3,6,6-trimethyl-2-methylidene-3-bicyclo[3.1.0]hexanyl]ethanol |
|---|---|
| PubChem CID | 11644027 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-[(1R,3R,5S)-3,6,6-trimethyl-2-methylidene-3-bicyclo[3.1.0]hexanyl]ethanol |
| SMILES | C=C1[C@@H]2[C@H](C[C@]1(C)CCO)C2(C)C |
| InChI | InChI=1S/C12H20O/c1-8-10-9(11(10,2)3)7-12(8,4)5-6-13/h9-10,13H,1,5-7H2,2-4H3/t9-,10+,12-/m0/s1 |
| InChIKey | RMOIIYSJQMUMHC-UMNHJUIQSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|