C9H10N2O3 — CID 11644073
(Z,4S)-4-(2,5-dioxopyrrolidin-1-yl)oxypent-2-enenitrile (PubChem CID 11644073) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is (Z,4S)-4-(2,5-dioxopyrrolidin-1-yl)oxypent-2-enenitrile.
| Compound Name | (Z,4S)-4-(2,5-dioxopyrrolidin-1-yl)oxypent-2-enenitrile |
|---|---|
| PubChem CID | 11644073 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (Z,4S)-4-(2,5-dioxopyrrolidin-1-yl)oxypent-2-enenitrile |
| SMILES | C[C@@H](/C=C\C#N)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H10N2O3/c1-7(3-2-6-10)14-11-8(12)4-5-9(11)13/h2-3,7H,4-5H2,1H3/b3-2-/t7-/m0/s1 |
| InChIKey | JVTXOINSIRKCTO-XDVGHUOJSA-N |
| XLogP | 0.54 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|