C13H20O2 — CID 11644147
(5S,7aR)-7a-(prop-2-enoxymethyl)-1,2,3,5,6,7-hexahydroinden-5-ol (PubChem CID 11644147) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (5S,7aR)-7a-(prop-2-enoxymethyl)-1,2,3,5,6,7-hexahydroinden-5-ol.
| Compound Name | (5S,7aR)-7a-(prop-2-enoxymethyl)-1,2,3,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 11644147 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (5S,7aR)-7a-(prop-2-enoxymethyl)-1,2,3,5,6,7-hexahydroinden-5-ol |
| SMILES | C=CCOC[C@@]12CCCC1=C[C@@H](O)CC2 |
| InChI | InChI=1S/C13H20O2/c1-2-8-15-10-13-6-3-4-11(13)9-12(14)5-7-13/h2,9,12,14H,1,3-8,10H2/t12-,13-/m0/s1 |
| InChIKey | WLNRHQMKQRZVFV-STQMWFEESA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|