About 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole
2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole (PubChem CID 11644196) has the molecular formula C13H13NS
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole |
| PubChem CID | 11644196 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole |
| SMILES | CC1=c2sc3ccccc3c2=NC1(C)C |
| InChI | InChI=1S/C13H13NS/c1-8-12-11(14-13(8,2)3)9-6-4-5-7-10(9)15-12/h4-7H,1-3H3 |
| InChIKey | WACVLPZBGDGFIE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole?
The IUPAC name of 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole (CID 11644196) is 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole.
What is the SMILES notation for 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole?
The canonical SMILES for 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole is CC1=c2sc3ccccc3c2=NC1(C)C.
What is the InChIKey of 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole?
The InChIKey is WACVLPZBGDGFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NS/c1-8-12-11(14-13(8,2)3)9-6-4-5-7-10(9)15-12/h4-7H,1-3H3.
What are the key properties of 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole?
2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole has a molecular weight of 215.32 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-[1]benzothiolo[3,2-b]pyrrole is sourced from PubChem (CID 11644196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).