C14H22O2 — CID 11644246
(4aR,5R,8S)-4a-hydroxy-5-methyl-8-propan-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 11644246) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (4aR,5R,8S)-4a-hydroxy-5-methyl-8-propan-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | (4aR,5R,8S)-4a-hydroxy-5-methyl-8-propan-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 11644246 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (4aR,5R,8S)-4a-hydroxy-5-methyl-8-propan-2-yl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)[C@]2(O)CCC(=O)C=C12 |
| InChI | InChI=1S/C14H22O2/c1-9(2)12-5-4-10(3)14(16)7-6-11(15)8-13(12)14/h8-10,12,16H,4-7H2,1-3H3/t10-,12+,14-/m1/s1 |
| InChIKey | QSCUHKDLNLVMNB-SCDSUCTJSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |