About tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate
tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate (PubChem CID 11644531) has the molecular formula C11H21F2NO3
and a molecular weight of 253.29 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate |
| PubChem CID | 11644531 |
| Molecular Formula | C11H21F2NO3 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate |
| SMILES | CC(F)(F)CC[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21F2NO3/c1-10(2,3)17-9(16)14-8(7-15)5-6-11(4,12)13/h8,15H,5-7H2,1-4H3,(H,14,16)/t8-/m0/s1 |
| InChIKey | MDEIPTYNNWMFSN-QMMMGPOBSA-N |
| XLogP | 2.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate (CID 11644531) is tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate is CC(F)(F)CC[C@@H](CO)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate?
The InChIKey is MDEIPTYNNWMFSN-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H21F2NO3/c1-10(2,3)17-9(16)14-8(7-15)5-6-11(4,12)13/h8,15H,5-7H2,1-4H3,(H,14,16)/t8-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate?
tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate has a molecular weight of 253.29 g/mol, XLogP of 2.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-5,5-difluoro-1-hydroxyhexan-2-yl]carbamate is sourced from PubChem (CID 11644531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).