About 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile
3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile (PubChem CID 11644537) has the molecular formula C16H19N3
and a molecular weight of 253.35 g/mol. Its IUPAC name is 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile |
| PubChem CID | 11644537 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile |
| SMILES | CN(C)C[C@H]1C[C@@H]1c1cn(C)c2ccc(C#N)cc12 |
| InChI | InChI=1S/C16H19N3/c1-18(2)9-12-7-13(12)15-10-19(3)16-5-4-11(8-17)6-14(15)16/h4-6,10,12-13H,7,9H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | KOGVQIODXLTVAN-OLZOCXBDSA-N |
| XLogP | 2.72 |
| TPSA | 31.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile?
The IUPAC name of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile (CID 11644537) is 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile.
What is the SMILES notation for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile?
The canonical SMILES for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile is CN(C)C[C@H]1C[C@@H]1c1cn(C)c2ccc(C#N)cc12.
What is the InChIKey of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile?
The InChIKey is KOGVQIODXLTVAN-OLZOCXBDSA-N. The full InChI is InChI=1S/C16H19N3/c1-18(2)9-12-7-13(12)15-10-19(3)16-5-4-11(8-17)6-14(15)16/h4-6,10,12-13H,7,9H2,1-3H3/t12-,13+/m1/s1.
What are the key properties of 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile?
3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile has a molecular weight of 253.35 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2S)-2-[(dimethylamino)methyl]cyclopropyl]-1-methylindole-5-carbonitrile is sourced from PubChem (CID 11644537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).