About 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid
3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid (PubChem CID 11644546) has the molecular formula C10H14N4O4
and a molecular weight of 254.25 g/mol. Its IUPAC name is 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid |
| PubChem CID | 11644546 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid |
| SMILES | CN(C)c1nc(C(=O)O)c(N(C)C)nc1C(=O)O |
| InChI | InChI=1S/C10H14N4O4/c1-13(2)7-5(9(15)16)12-8(14(3)4)6(11-7)10(17)18/h1-4H3,(H,15,16)(H,17,18) |
| InChIKey | WFNRTJKSJFNPBB-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid?
The IUPAC name of 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid (CID 11644546) is 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid.
What is the SMILES notation for 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid?
The canonical SMILES for 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid is CN(C)c1nc(C(=O)O)c(N(C)C)nc1C(=O)O.
What is the InChIKey of 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid?
The InChIKey is WFNRTJKSJFNPBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O4/c1-13(2)7-5(9(15)16)12-8(14(3)4)6(11-7)10(17)18/h1-4H3,(H,15,16)(H,17,18).
What are the key properties of 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid?
3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid has a molecular weight of 254.25 g/mol, XLogP of 0.00, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(dimethylamino)pyrazine-2,5-dicarboxylic acid is sourced from PubChem (CID 11644546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).