C12H19NO6 — CID 11644762
(3R,7R,8R,9R)-8-(methoxymethoxy)-5,5-dimethyl-4,6,11-trioxa-1-azatricyclo[7.3.0.03,7]dodecan-12-one (PubChem CID 11644762) has the molecular formula C12H19NO6 and a molecular weight of 273.29 g/mol. Its IUPAC name is (3R,7R,8R,9R)-8-(methoxymethoxy)-5,5-dimethyl-4,6,11-trioxa-1-azatricyclo[7.3.0.03,7]dodecan-12-one.
| Compound Name | (3R,7R,8R,9R)-8-(methoxymethoxy)-5,5-dimethyl-4,6,11-trioxa-1-azatricyclo[7.3.0.03,7]dodecan-12-one |
|---|---|
| PubChem CID | 11644762 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (3R,7R,8R,9R)-8-(methoxymethoxy)-5,5-dimethyl-4,6,11-trioxa-1-azatricyclo[7.3.0.03,7]dodecan-12-one |
| SMILES | COCO[C@H]1[C@@H]2OC(C)(C)O[C@@H]2CN2C(=O)OC[C@H]12 |
| InChI | InChI=1S/C12H19NO6/c1-12(2)18-8-4-13-7(5-16-11(13)14)9(10(8)19-12)17-6-15-3/h7-10H,4-6H2,1-3H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | HIIDFSNVRYJESE-ZYUZMQFOSA-N |
| XLogP | 0.33 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|