C21H21N2+ — CID 11645116
2-[4-[(E)-2-(4-phenylphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 11645116) has the molecular formula C21H21N2+ and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-phenylphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
| Compound Name | 2-[4-[(E)-2-(4-phenylphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
|---|---|
| PubChem CID | 11645116 |
| Molecular Formula | C21H21N2+ |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-[4-[(E)-2-(4-phenylphenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | NCC[n+]1ccc(/C=C/c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H21N2/c22-14-17-23-15-12-19(13-16-23)7-6-18-8-10-21(11-9-18)20-4-2-1-3-5-20/h1-13,15-16H,14,17,22H2/q+1/b7-6+ |
| InChIKey | LOEISEZZKYSNCQ-VOTSOKGWSA-N |
| XLogP | 3.77 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|