About ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate
ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate (PubChem CID 1164515) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate |
| PubChem CID | 1164515 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H23NO3/c1-5-17-11(15)10-6-8-14(9-7-10)12(16)13(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | IIRMPFJXCCCLAP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate (CID 1164515) is ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)C(C)(C)C)CC1.
What is the InChIKey of ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate?
The InChIKey is IIRMPFJXCCCLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c1-5-17-11(15)10-6-8-14(9-7-10)12(16)13(2,3)4/h10H,5-9H2,1-4H3.
What are the key properties of ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate?
ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate has a molecular weight of 241.33 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate is sourced from PubChem (CID 1164515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).