About 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol
3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol (PubChem CID 11645371) has the molecular formula C16H19F3OS
and a molecular weight of 316.39 g/mol. Its IUPAC name is 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol |
| PubChem CID | 11645371 |
| Molecular Formula | C16H19F3OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol |
| SMILES | CC(=C=CC(C)C)C(S)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3OS/c1-11(2)4-5-12(3)15(21)10-20-14-8-6-13(7-9-14)16(17,18)19/h4,6-9,11,15,21H,10H2,1-3H3 |
| InChIKey | VLDHOWUTKRMRLF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol?
The IUPAC name of 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol (CID 11645371) is 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol.
What is the SMILES notation for 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol?
The canonical SMILES for 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol is CC(=C=CC(C)C)C(S)COc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol?
The InChIKey is VLDHOWUTKRMRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F3OS/c1-11(2)4-5-12(3)15(21)10-20-14-8-6-13(7-9-14)16(17,18)19/h4,6-9,11,15,21H,10H2,1-3H3.
What are the key properties of 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol?
3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol has a molecular weight of 316.39 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-[4-(trifluoromethyl)phenoxy]hepta-3,4-diene-2-thiol is sourced from PubChem (CID 11645371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).