C14H19N3O4S — CID 11645536
(2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-6-phenylsulfanyloxan-3-ol (PubChem CID 11645536) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-6-phenylsulfanyloxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-6-phenylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 11645536 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-6-phenylsulfanyloxan-3-ol |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](O)[C@@H](CN=[N+]=[N-])O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C14H19N3O4S/c1-19-12-11(18)10(8-16-17-15)21-14(13(12)20-2)22-9-6-4-3-5-7-9/h3-7,10-14,18H,8H2,1-2H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | UDWTUMZFUQMEPY-RGDJUOJXSA-N |
| XLogP | 2.20 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|