About (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone
(4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone (PubChem CID 11645570) has the molecular formula C18H17NO5
and a molecular weight of 327.34 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone.
Molecular Properties
| Compound Name | (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone |
| PubChem CID | 11645570 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone |
| SMILES | COc1ccc2c(C(=O)c3cc(OC)c(O)c(OC)c3)c[nH]c2c1 |
| InChI | InChI=1S/C18H17NO5/c1-22-11-4-5-12-13(9-19-14(12)8-11)17(20)10-6-15(23-2)18(21)16(7-10)24-3/h4-9,19,21H,1-3H3 |
| InChIKey | ZPZUSIUTOXRAIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone?
The IUPAC name of (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone (CID 11645570) is (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone.
What is the SMILES notation for (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone?
The canonical SMILES for (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone is COc1ccc2c(C(=O)c3cc(OC)c(O)c(OC)c3)c[nH]c2c1.
What is the InChIKey of (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone?
The InChIKey is ZPZUSIUTOXRAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO5/c1-22-11-4-5-12-13(9-19-14(12)8-11)17(20)10-6-15(23-2)18(21)16(7-10)24-3/h4-9,19,21H,1-3H3.
What are the key properties of (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone?
(4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone has a molecular weight of 327.34 g/mol, XLogP of 3.13, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-3,5-dimethoxyphenyl)-(6-methoxy-1H-indol-3-yl)methanone is sourced from PubChem (CID 11645570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).