About 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide
6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide (PubChem CID 11645614) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide.
Molecular Properties
| Compound Name | 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide |
| PubChem CID | 11645614 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide |
| SMILES | Cc1cn(Cc2ccc(CCCCCC(N)=O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H23N3O3/c1-13-11-21(18(24)20-17(13)23)12-15-9-7-14(8-10-15)5-3-2-4-6-16(19)22/h7-11H,2-6,12H2,1H3,(H2,19,22)(H,20,23,24) |
| InChIKey | MOZTUKMQMWQZTL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide?
The IUPAC name of 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide (CID 11645614) is 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide.
What is the SMILES notation for 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide?
The canonical SMILES for 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide is Cc1cn(Cc2ccc(CCCCCC(N)=O)cc2)c(=O)[nH]c1=O.
What is the InChIKey of 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide?
The InChIKey is MOZTUKMQMWQZTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-13-11-21(18(24)20-17(13)23)12-15-9-7-14(8-10-15)5-3-2-4-6-16(19)22/h7-11H,2-6,12H2,1H3,(H2,19,22)(H,20,23,24).
What are the key properties of 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide?
6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide has a molecular weight of 329.40 g/mol, XLogP of 1.48, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]phenyl]hexanamide is sourced from PubChem (CID 11645614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).