About N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide
N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide (PubChem CID 11645799) has the molecular formula C21H25NOS
and a molecular weight of 339.50 g/mol. Its IUPAC name is N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide.
Molecular Properties
| Compound Name | N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide |
| PubChem CID | 11645799 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide |
| SMILES | C[C@@]1(O)CCCC[C@H]1[C@@H](NC(=S)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NOS/c1-21(23)15-9-8-14-18(21)19(16-10-4-2-5-11-16)22-20(24)17-12-6-3-7-13-17/h2-7,10-13,18-19,23H,8-9,14-15H2,1H3,(H,22,24)/t18-,19-,21+/m0/s1 |
| InChIKey | OIXXHFFFTYGDFQ-IRFCIJBXSA-N |
| XLogP | 4.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide?
The IUPAC name of N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide (CID 11645799) is N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide.
What is the SMILES notation for N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide?
The canonical SMILES for N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide is C[C@@]1(O)CCCC[C@H]1[C@@H](NC(=S)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide?
The InChIKey is OIXXHFFFTYGDFQ-IRFCIJBXSA-N. The full InChI is InChI=1S/C21H25NOS/c1-21(23)15-9-8-14-18(21)19(16-10-4-2-5-11-16)22-20(24)17-12-6-3-7-13-17/h2-7,10-13,18-19,23H,8-9,14-15H2,1H3,(H,22,24)/t18-,19-,21+/m0/s1.
What are the key properties of N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide?
N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide has a molecular weight of 339.50 g/mol, XLogP of 4.63, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(R)-[(1S,2R)-2-hydroxy-2-methylcyclohexyl]-phenylmethyl]benzenecarbothioamide is sourced from PubChem (CID 11645799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).