C15H10F4N2O3 — CID 11645847
[4-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)phenyl]urea (PubChem CID 11645847) has the molecular formula C15H10F4N2O3 and a molecular weight of 342.25 g/mol. Its IUPAC name is [4-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)phenyl]urea.
| Compound Name | [4-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)phenyl]urea |
|---|---|
| PubChem CID | 11645847 |
| Molecular Formula | C15H10F4N2O3 |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [4-(2,2,4,4-tetrafluoro-1,3-benzodioxin-6-yl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(-c2ccc3c(c2)C(F)(F)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C15H10F4N2O3/c16-14(17)11-7-9(3-6-12(11)23-15(18,19)24-14)8-1-4-10(5-2-8)21-13(20)22/h1-7H,(H3,20,21,22) |
| InChIKey | KYVPAWNNIAVBKU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |