C16H11N7O3 — CID 11645981
1-(3-nitrophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea (PubChem CID 11645981) has the molecular formula C16H11N7O3 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea.
| Compound Name | 1-(3-nitrophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea |
|---|---|
| PubChem CID | 11645981 |
| Molecular Formula | C16H11N7O3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-nitrophenyl)-3-(4,6,8,9-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,7,10,12-hexaen-3-yl)urea |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)Nc1ncnc2nn3ccccc3c12 |
| InChI | InChI=1S/C16H11N7O3/c24-16(19-10-4-3-5-11(8-10)23(25)26)20-14-13-12-6-1-2-7-22(12)21-15(13)18-9-17-14/h1-9H,(H2,17,18,19,20,21,24) |
| InChIKey | XIDJQQGLLNEFTP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 127.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|