C20H18N4O3 — CID 11646232
3-benzyl-5-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 11646232) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-benzyl-5-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 3-benzyl-5-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 11646232 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-benzyl-5-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | COc1ccc(-c2cnc3[nH]c(=O)n(Cc4ccccc4)c3n2)c(OC)c1 |
| InChI | InChI=1S/C20H18N4O3/c1-26-14-8-9-15(17(10-14)27-2)16-11-21-18-19(22-16)24(20(25)23-18)12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3,(H,21,23,25) |
| InChIKey | AOBNJNPWTLZZJA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |