C14H20O9S — CID 11646270
[(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxythian-2-yl]methyl acetate (PubChem CID 11646270) has the molecular formula C14H20O9S and a molecular weight of 364.37 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxythian-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxythian-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11646270 |
| Molecular Formula | C14H20O9S |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5-triacetyloxy-6-hydroxythian-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1SC(O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H20O9S/c1-6(15)20-5-10-11(21-7(2)16)12(22-8(3)17)13(14(19)24-10)23-9(4)18/h10-14,19H,5H2,1-4H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | OSZSMFQZURNRHS-RQICVUQASA-N |
| XLogP | -0.22 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|