About 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea
1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea (PubChem CID 11646277) has the molecular formula C21H24N4O2
and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
| PubChem CID | 11646277 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea |
| SMILES | CC(C)(C)c1ccc2c(c1)OCCC2NC(=O)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C21H24N4O2/c1-21(2,3)13-7-8-14-17(9-10-27-19(14)11-13)24-20(26)23-16-5-4-6-18-15(16)12-22-25-18/h4-8,11-12,17H,9-10H2,1-3H3,(H,22,25)(H2,23,24,26) |
| InChIKey | OMIRFNXDMYBLLF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The IUPAC name of 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea (CID 11646277) is 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea.
What is the SMILES notation for 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The canonical SMILES for 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea is CC(C)(C)c1ccc2c(c1)OCCC2NC(=O)Nc1cccc2[nH]ncc12.
What is the InChIKey of 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
The InChIKey is OMIRFNXDMYBLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O2/c1-21(2,3)13-7-8-14-17(9-10-27-19(14)11-13)24-20(26)23-16-5-4-6-18-15(16)12-22-25-18/h4-8,11-12,17H,9-10H2,1-3H3,(H,22,25)(H2,23,24,26).
What are the key properties of 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea?
1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea has a molecular weight of 364.45 g/mol, XLogP of 4.51, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-tert-butyl-3,4-dihydro-2H-chromen-4-yl)-3-(1H-indazol-4-yl)urea is sourced from PubChem (CID 11646277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).