C15H18ClFN6O2 — CID 11646367
ethyl 4-[[2-(5-chloro-2-fluorophenyl)tetrazol-5-yl]methyl]piperazine-1-carboxylate (PubChem CID 11646367) has the molecular formula C15H18ClFN6O2 and a molecular weight of 368.80 g/mol. Its IUPAC name is ethyl 4-[[2-(5-chloro-2-fluorophenyl)tetrazol-5-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(5-chloro-2-fluorophenyl)tetrazol-5-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11646367 |
| Molecular Formula | C15H18ClFN6O2 |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 4-[[2-(5-chloro-2-fluorophenyl)tetrazol-5-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2nnn(-c3cc(Cl)ccc3F)n2)CC1 |
| InChI | InChI=1S/C15H18ClFN6O2/c1-2-25-15(24)22-7-5-21(6-8-22)10-14-18-20-23(19-14)13-9-11(16)3-4-12(13)17/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | SKSUCCHHYXGTKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |