About 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol
2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol (PubChem CID 11646379) has the molecular formula C22H31N3O2
and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol |
| PubChem CID | 11646379 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol |
| SMILES | CCCCCCC(N1CCOCC1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C22H31N3O2/c1-2-3-4-5-10-21(25-13-15-27-16-14-25)22(26,19-8-6-11-23-17-19)20-9-7-12-24-18-20/h6-9,11-12,17-18,21,26H,2-5,10,13-16H2,1H3 |
| InChIKey | PUFFDHPIZWKLSX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol?
The IUPAC name of 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol (CID 11646379) is 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol.
What is the SMILES notation for 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol?
The canonical SMILES for 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol is CCCCCCC(N1CCOCC1)C(O)(c1cccnc1)c1cccnc1.
What is the InChIKey of 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol?
The InChIKey is PUFFDHPIZWKLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31N3O2/c1-2-3-4-5-10-21(25-13-15-27-16-14-25)22(26,19-8-6-11-23-17-19)20-9-7-12-24-18-20/h6-9,11-12,17-18,21,26H,2-5,10,13-16H2,1H3.
What are the key properties of 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol?
2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol has a molecular weight of 369.51 g/mol, XLogP of 3.38, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,1-dipyridin-3-yloctan-1-ol is sourced from PubChem (CID 11646379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).