About 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid
2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 11646408) has the molecular formula C22H17N3O3
and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| PubChem CID | 11646408 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#C/C(=C\c1cn(CC(=O)O)c2ccccc12)C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H17N3O3/c23-12-16(22(28)25-10-9-15-5-1-3-7-19(15)25)11-17-13-24(14-21(26)27)20-8-4-2-6-18(17)20/h1-8,11,13H,9-10,14H2,(H,26,27)/b16-11+ |
| InChIKey | HMLVYNGGOOQKLY-LFIBNONCSA-N |
| XLogP | 3.22 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid?
The IUPAC name of 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid (CID 11646408) is 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid?
The canonical SMILES for 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid is N#C/C(=C\c1cn(CC(=O)O)c2ccccc12)C(=O)N1CCc2ccccc21.
What is the InChIKey of 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid?
The InChIKey is HMLVYNGGOOQKLY-LFIBNONCSA-N. The full InChI is InChI=1S/C22H17N3O3/c23-12-16(22(28)25-10-9-15-5-1-3-7-19(15)25)11-17-13-24(14-21(26)27)20-8-4-2-6-18(17)20/h1-8,11,13H,9-10,14H2,(H,26,27)/b16-11+.
What are the key properties of 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid?
2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid has a molecular weight of 371.40 g/mol, XLogP of 3.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(E)-2-cyano-3-(2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]indol-1-yl]acetic acid is sourced from PubChem (CID 11646408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).