C21H30O6 — CID 11646557
(1R,2S,4R,6S,7S,10S,11R,13R,14S,16R)-6-acetyl-13,14,16-trihydroxy-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-17-one (PubChem CID 11646557) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (1R,2S,4R,6S,7S,10S,11R,13R,14S,16R)-6-acetyl-13,14,16-trihydroxy-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-17-one.
| Compound Name | (1R,2S,4R,6S,7S,10S,11R,13R,14S,16R)-6-acetyl-13,14,16-trihydroxy-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-17-one |
|---|---|
| PubChem CID | 11646557 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (1R,2S,4R,6S,7S,10S,11R,13R,14S,16R)-6-acetyl-13,14,16-trihydroxy-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadecan-17-one |
| SMILES | CC(=O)[C@@]12O[C@@H]1C[C@H]1[C@@H]3CC(=O)[C@@]4(O)C[C@H](O)[C@H](O)C[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | InChI=1S/C21H30O6/c1-10(22)21-17(27-21)7-13-11-6-16(25)20(26)9-15(24)14(23)8-19(20,3)12(11)4-5-18(13,21)2/h11-15,17,23-24,26H,4-9H2,1-3H3/t11-,12+,13+,14-,15+,17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | HTGAEPGKDZOAFM-NZZXLGMLSA-N |
| XLogP | 0.99 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|