About 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide
3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11646675) has the molecular formula C15H18ClN7O
and a molecular weight of 347.81 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide |
| PubChem CID | 11646675 |
| Molecular Formula | C15H18ClN7O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCc1ccccc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C15H18ClN7O/c16-11-13(18)22-12(17)10(21-11)14(24)23-15(19)20-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H4,17,18,22)(H3,19,20,23,24) |
| InChIKey | IMPHOLNVUFEBJF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide?
The IUPAC name of 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide (CID 11646675) is 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide.
What is the SMILES notation for 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide?
The canonical SMILES for 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide is N/C(=N\CCCc1ccccc1)NC(=O)c1nc(Cl)c(N)nc1N.
What is the InChIKey of 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide?
The InChIKey is IMPHOLNVUFEBJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN7O/c16-11-13(18)22-12(17)10(21-11)14(24)23-15(19)20-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H4,17,18,22)(H3,19,20,23,24).
What are the key properties of 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide?
3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide has a molecular weight of 347.81 g/mol, XLogP of 0.97, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-6-chloro-N-[N'-(3-phenylpropyl)carbamimidoyl]pyrazine-2-carboxamide is sourced from PubChem (CID 11646675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).