C18H29NO8 — CID 11646741
methyl (2R,3aR,7aR)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate (PubChem CID 11646741) has the molecular formula C18H29NO8 and a molecular weight of 387.43 g/mol. Its IUPAC name is methyl (2R,3aR,7aR)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate.
| Compound Name | methyl (2R,3aR,7aR)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11646741 |
| Molecular Formula | C18H29NO8 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | methyl (2R,3aR,7aR)-2-[(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-carboxylate |
| SMILES | COC(=O)[C@H](C[C@]1(C(=O)OC)C[C@H]2OCCC[C@H]2O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO8/c1-17(2,3)27-16(22)19-11(14(20)23-4)9-18(15(21)24-5)10-13-12(26-18)7-6-8-25-13/h11-13H,6-10H2,1-5H3,(H,19,22)/t11-,12+,13+,18+/m0/s1 |
| InChIKey | POVVUQXIVLABDI-NVAPZFDKSA-N |
| XLogP | 1.32 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|