C22H28O6 — CID 11646757
[(1S,3R,8R,10R,11R,12R,17R)-12,16,16-trimethyl-6-oxo-2,7,9-trioxahexacyclo[9.8.0.01,3.04,8.08,10.012,17]nonadec-4-en-5-yl]methyl acetate (PubChem CID 11646757) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(1S,3R,8R,10R,11R,12R,17R)-12,16,16-trimethyl-6-oxo-2,7,9-trioxahexacyclo[9.8.0.01,3.04,8.08,10.012,17]nonadec-4-en-5-yl]methyl acetate.
| Compound Name | [(1S,3R,8R,10R,11R,12R,17R)-12,16,16-trimethyl-6-oxo-2,7,9-trioxahexacyclo[9.8.0.01,3.04,8.08,10.012,17]nonadec-4-en-5-yl]methyl acetate |
|---|---|
| PubChem CID | 11646757 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(1S,3R,8R,10R,11R,12R,17R)-12,16,16-trimethyl-6-oxo-2,7,9-trioxahexacyclo[9.8.0.01,3.04,8.08,10.012,17]nonadec-4-en-5-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2[C@H]3O[C@]34CC[C@@H]3C(C)(C)CCC[C@@]3(C)[C@@H]4[C@H]3O[C@@]23OC1=O |
| InChI | InChI=1S/C22H28O6/c1-11(23)25-10-12-14-16-21(26-16)9-6-13-19(2,3)7-5-8-20(13,4)15(21)17-22(14,27-17)28-18(12)24/h13,15-17H,5-10H2,1-4H3/t13-,15+,16-,17-,20-,21+,22-/m1/s1 |
| InChIKey | GYXLGRPTVRBMFK-OVURXTQHSA-N |
| XLogP | 2.89 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|