C18H20F5N5 — CID 11647016
(1S,2R,5S)-2-(2,5-difluorophenyl)-5-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexan-1-amine (PubChem CID 11647016) has the molecular formula C18H20F5N5 and a molecular weight of 401.38 g/mol. Its IUPAC name is (1S,2R,5S)-2-(2,5-difluorophenyl)-5-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-2-(2,5-difluorophenyl)-5-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 11647016 |
| Molecular Formula | C18H20F5N5 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (1S,2R,5S)-2-(2,5-difluorophenyl)-5-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2CCn3c(nnc3C(F)(F)F)C2)CC[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C18H20F5N5/c19-10-1-4-14(20)13(7-10)12-3-2-11(8-15(12)24)27-5-6-28-16(9-27)25-26-17(28)18(21,22)23/h1,4,7,11-12,15H,2-3,5-6,8-9,24H2/t11-,12+,15-/m0/s1 |
| InChIKey | OGUOZGSSURPWKS-ZOWXZIJZSA-N |
| XLogP | 3.05 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |