About 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile
2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile (PubChem CID 11647122) has the molecular formula C23H17F2N3S
and a molecular weight of 405.47 g/mol. Its IUPAC name is 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile |
| PubChem CID | 11647122 |
| Molecular Formula | C23H17F2N3S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile |
| SMILES | CNc1ccc2c(Sc3ccccc3C#N)cn(Cc3cc(F)cc(F)c3)c2c1 |
| InChI | InChI=1S/C23H17F2N3S/c1-27-19-6-7-20-21(11-19)28(13-15-8-17(24)10-18(25)9-15)14-23(20)29-22-5-3-2-4-16(22)12-26/h2-11,14,27H,13H2,1H3 |
| InChIKey | BSXCJNDVWKVFSF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile?
The IUPAC name of 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile (CID 11647122) is 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile.
What is the SMILES notation for 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile?
The canonical SMILES for 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile is CNc1ccc2c(Sc3ccccc3C#N)cn(Cc3cc(F)cc(F)c3)c2c1.
What is the InChIKey of 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile?
The InChIKey is BSXCJNDVWKVFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17F2N3S/c1-27-19-6-7-20-21(11-19)28(13-15-8-17(24)10-18(25)9-15)14-23(20)29-22-5-3-2-4-16(22)12-26/h2-11,14,27H,13H2,1H3.
What are the key properties of 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile?
2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile has a molecular weight of 405.47 g/mol, XLogP of 6.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3,5-difluorophenyl)methyl]-6-(methylamino)indol-3-yl]sulfanylbenzonitrile is sourced from PubChem (CID 11647122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).