C26H31NO4 — CID 11647468
1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid (PubChem CID 11647468) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid.
| Compound Name | 1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 11647468 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(OCC(=O)Cn2ccc3ccc(C(=O)O)cc32)cc1 |
| InChI | InChI=1S/C26H31NO4/c1-2-3-4-5-6-7-8-20-9-13-24(14-10-20)31-19-23(28)18-27-16-15-21-11-12-22(26(29)30)17-25(21)27/h9-17H,2-8,18-19H2,1H3,(H,29,30) |
| InChIKey | YRYOEVQZRFTJRH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|