C24H30O7 — CID 11647652
(2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-1,4,5,8-tetrone (PubChem CID 11647652) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-1,4,5,8-tetrone.
| Compound Name | (2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-1,4,5,8-tetrone |
|---|---|
| PubChem CID | 11647652 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (2R,4aR,4bS,10aS,10bS,12aR)-6,10b-dihydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-4a,9,10,11-tetrahydronaphtho[1,2-h]isochromene-1,4,5,8-tetrone |
| SMILES | C=C1C[C@]2(O)[C@@]3(C)CCC(=O)C(C)(C)C3=C(O)C(=O)[C@@]2(C)[C@@H]2C(=O)O[C@H](C)C(=O)[C@@]12C |
| InChI | InChI=1S/C24H30O7/c1-11-10-24(30)21(5)9-8-13(25)20(3,4)15(21)14(26)18(28)23(24,7)16-19(29)31-12(2)17(27)22(11,16)6/h12,16,26,30H,1,8-10H2,2-7H3/t12-,16-,21+,22+,23-,24+/m1/s1 |
| InChIKey | BSUMMOUMVQVPGZ-VSFXBCNKSA-N |
| XLogP | 2.61 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|