C21H24N2O4S2 — CID 11647697
S-[2-[4-[ethyl(5,6,7,8-tetrahydroisoquinolin-3-ylsulfonyl)amino]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 11647697) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is S-[2-[4-[ethyl(5,6,7,8-tetrahydroisoquinolin-3-ylsulfonyl)amino]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[ethyl(5,6,7,8-tetrahydroisoquinolin-3-ylsulfonyl)amino]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11647697 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | S-[2-[4-[ethyl(5,6,7,8-tetrahydroisoquinolin-3-ylsulfonyl)amino]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CCN(c1ccc(C(=O)CSC(C)=O)cc1)S(=O)(=O)c1cc2c(cn1)CCCC2 |
| InChI | InChI=1S/C21H24N2O4S2/c1-3-23(19-10-8-16(9-11-19)20(25)14-28-15(2)24)29(26,27)21-12-17-6-4-5-7-18(17)13-22-21/h8-13H,3-7,14H2,1-2H3 |
| InChIKey | SYWKHSOQRCVRMC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|