About 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid
2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 11648347) has the molecular formula C26H22FNO4S
and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid |
| PubChem CID | 11648347 |
| Molecular Formula | C26H22FNO4S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)c2nc(-c3ccc(F)cc3)c(CC(=O)O)s2)cc1 |
| InChI | InChI=1S/C26H22FNO4S/c1-31-20-11-5-16(6-12-20)24(17-7-13-21(32-2)14-8-17)26-28-25(22(33-26)15-23(29)30)18-3-9-19(27)10-4-18/h3-14,24H,15H2,1-2H3,(H,29,30) |
| InChIKey | ZOTGQGLOXKIJDG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid (CID 11648347) is 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid is COc1ccc(C(c2ccc(OC)cc2)c2nc(-c3ccc(F)cc3)c(CC(=O)O)s2)cc1.
What is the InChIKey of 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid?
The InChIKey is ZOTGQGLOXKIJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22FNO4S/c1-31-20-11-5-16(6-12-20)24(17-7-13-21(32-2)14-8-17)26-28-25(22(33-26)15-23(29)30)18-3-9-19(27)10-4-18/h3-14,24H,15H2,1-2H3,(H,29,30).
What are the key properties of 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid?
2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid has a molecular weight of 463.53 g/mol, XLogP of 5.77, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[bis(4-methoxyphenyl)methyl]-4-(4-fluorophenyl)-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 11648347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).