About N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide
N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide (PubChem CID 11648548) has the molecular formula C25H22N4O4S
and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide |
| PubChem CID | 11648548 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)nc3)c2cc1OC |
| InChI | InChI=1S/C25H22N4O4S/c1-31-21-13-18-19(14-22(21)32-2)26-11-10-20(18)33-17-8-9-23(27-15-17)28-25(34)29-24(30)12-16-6-4-3-5-7-16/h3-11,13-15H,12H2,1-2H3,(H2,27,28,29,30,34) |
| InChIKey | VNBTUVIGSBDLHI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide?
The IUPAC name of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide (CID 11648548) is N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide.
What is the SMILES notation for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide?
The canonical SMILES for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide is COc1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)nc3)c2cc1OC.
What is the InChIKey of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide?
The InChIKey is VNBTUVIGSBDLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O4S/c1-31-21-13-18-19(14-22(21)32-2)26-11-10-20(18)33-17-8-9-23(27-15-17)28-25(34)29-24(30)12-16-6-4-3-5-7-16/h3-11,13-15H,12H2,1-2H3,(H2,27,28,29,30,34).
What are the key properties of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide?
N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide has a molecular weight of 474.54 g/mol, XLogP of 4.49, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamothioyl]-2-phenylacetamide is sourced from PubChem (CID 11648548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).