C28H37NO7 — CID 11649008
(4R)-4-benzyl-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11649008) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11649008 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H37NO7/c1-18(15-35-16-22-10-12-24(34-4)13-11-22)25(30)19(2)26(31)20(3)27(32)29-23(17-36-28(29)33)14-21-8-6-5-7-9-21/h5-13,18-20,23,25-26,30-31H,14-17H2,1-4H3/t18-,19+,20-,23-,25-,26-/m1/s1 |
| InChIKey | ZOBCJVLREAAZMQ-CGERSKTJSA-N |
| XLogP | 3.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |