About 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine (PubChem CID 11649027) has the molecular formula C23H19Cl5N2
and a molecular weight of 500.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine |
| PubChem CID | 11649027 |
| Molecular Formula | C23H19Cl5N2 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine |
| SMILES | Clc1ccc(C2CN(Cc3c(Cl)cccc3Cl)CCN2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H19Cl5N2/c24-16-6-4-15(5-7-16)23-14-29(13-18-19(26)2-1-3-20(18)27)10-11-30(23)22-9-8-17(25)12-21(22)28/h1-9,12,23H,10-11,13-14H2 |
| InChIKey | MVIFJHINEPQTFW-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine?
The IUPAC name of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine (CID 11649027) is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine.
What is the SMILES notation for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine?
The canonical SMILES for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine is Clc1ccc(C2CN(Cc3c(Cl)cccc3Cl)CCN2c2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine?
The InChIKey is MVIFJHINEPQTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19Cl5N2/c24-16-6-4-15(5-7-16)23-14-29(13-18-19(26)2-1-3-20(18)27)10-11-30(23)22-9-8-17(25)12-21(22)28/h1-9,12,23H,10-11,13-14H2.
What are the key properties of 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine?
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine has a molecular weight of 500.68 g/mol, XLogP of 8.02, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-[(2,6-dichlorophenyl)methyl]piperazine is sourced from PubChem (CID 11649027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).