C30H41NO5Si — CID 11649363
(NZ)-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-enylidene]hydroxylamine (PubChem CID 11649363) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is (NZ)-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 11649363 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (NZ)-N-[(Z,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(1R,4S,6R)-6-(methoxymethoxy)-4-(methoxymethyl)cyclohex-2-en-1-yl]but-2-enylidene]hydroxylamine |
| SMILES | COCO[C@@H]1C[C@H](COC)C=C[C@H]1[C@@H](/C=C\C=N/O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H41NO5Si/c1-30(2,3)37(25-13-8-6-9-14-25,26-15-10-7-11-16-26)36-28(17-12-20-31-32)27-19-18-24(22-33-4)21-29(27)35-23-34-5/h6-20,24,27-29,32H,21-23H2,1-5H3/b17-12-,31-20-/t24-,27+,28-,29-/m1/s1 |
| InChIKey | RJYHVPZTKSIODW-SEGKOYOSSA-N |
| XLogP | 4.78 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|