C27H56O4Si3 — CID 11649424
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]cyclohexan-1-one (PubChem CID 11649424) has the molecular formula C27H56O4Si3 and a molecular weight of 529.00 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]cyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 11649424 |
| Molecular Formula | C27H56O4Si3 |
| Molecular Weight | 529.00 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-[tert-butyl(dimethyl)silyl]oxypropylidene]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC=C1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O4Si3/c1-25(2,3)32(10,11)29-18-16-17-22-23(30-33(12,13)26(4,5)6)19-21(28)20-24(22)31-34(14,15)27(7,8)9/h17,23-24H,16,18-20H2,1-15H3/t23-,24-/m1/s1 |
| InChIKey | UHUZPIDIBTWSOP-DNQXCXABSA-N |
| XLogP | 8.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.00 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|