C25H16F9N5 — CID 11649748
1-[4,5-bis(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 11649748) has the molecular formula C25H16F9N5 and a molecular weight of 557.42 g/mol. Its IUPAC name is 1-[4,5-bis(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[4,5-bis(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 11649748 |
| Molecular Formula | C25H16F9N5 |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 1-[4,5-bis(3,4,5-trifluorophenyl)-1H-imidazol-2-yl]-4-[3-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | Fc1cc(-c2nc(N3CCN(c4ncccc4C(F)(F)F)CC3)[nH]c2-c2cc(F)c(F)c(F)c2)cc(F)c1F |
| InChI | InChI=1S/C25H16F9N5/c26-15-8-12(9-16(27)19(15)30)21-22(13-10-17(28)20(31)18(29)11-13)37-24(36-21)39-6-4-38(5-7-39)23-14(25(32,33)34)2-1-3-35-23/h1-3,8-11H,4-7H2,(H,36,37) |
| InChIKey | FLPVVIRZFZVXJN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|