C12H16ClNO3 — CID 116502016
2-(3-chloroanilino)-4-methoxy-3-methylbutanoic acid (PubChem CID 116502016) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is 2-(3-chloroanilino)-4-methoxy-3-methylbutanoic acid.
| Compound Name | 2-(3-chloroanilino)-4-methoxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 116502016 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-(3-chloroanilino)-4-methoxy-3-methylbutanoic acid |
| SMILES | COCC(C)C(Nc1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C12H16ClNO3/c1-8(7-17-2)11(12(15)16)14-10-5-3-4-9(13)6-10/h3-6,8,11,14H,7H2,1-2H3,(H,15,16) |
| InChIKey | KUJUKAPLPAKKPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |