C34H36N4O5S — CID 11650215
(E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid (PubChem CID 11650215) has the molecular formula C34H36N4O5S and a molecular weight of 612.75 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11650215 |
| Molecular Formula | C34H36N4O5S |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(1,3-thiazol-2-yl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]-2-ethoxyphenyl]prop-2-enoic acid |
| SMILES | CCOc1cc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5nccs5)n(C)c4c3)CCC2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C34H36N4O5S/c1-3-43-27-20-24(12-9-21(27)11-14-28(39)40)36-33(42)34(15-6-16-34)37-31(41)23-10-13-25-26(19-23)38(2)30(32-35-17-18-44-32)29(25)22-7-4-5-8-22/h9-14,17-20,22H,3-8,15-16H2,1-2H3,(H,36,42)(H,37,41)(H,39,40)/b14-11+ |
| InChIKey | BILZQVPFNQRLKR-SDNWHVSQSA-N |
| XLogP | 6.75 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|