About 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine (PubChem CID 116502415) has the molecular formula C12H22N2OS
and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine |
| PubChem CID | 116502415 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine |
| SMILES | CCc1nc(C(NC)C(C)COC)sc1C |
| InChI | InChI=1S/C12H22N2OS/c1-6-10-9(3)16-12(14-10)11(13-4)8(2)7-15-5/h8,11,13H,6-7H2,1-5H3 |
| InChIKey | LBQHMTVFYDNTBK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine?
The IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine (CID 116502415) is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine is CCc1nc(C(NC)C(C)COC)sc1C.
What is the InChIKey of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine?
The InChIKey is LBQHMTVFYDNTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2OS/c1-6-10-9(3)16-12(14-10)11(13-4)8(2)7-15-5/h8,11,13H,6-7H2,1-5H3.
What are the key properties of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine?
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine has a molecular weight of 242.39 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-3-methoxy-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 116502415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).